About 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol
3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol (PubChem CID 59492612) has the molecular formula C14H10F3NO
and a molecular weight of 265.23 g/mol. Its IUPAC name is 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol.
Molecular Properties
| Compound Name | 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol |
| PubChem CID | 59492612 |
| Molecular Formula | C14H10F3NO |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol |
| SMILES | Cc1cnc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C14H10F3NO/c1-8-6-11-12(18-7-8)9-4-2-3-5-10(9)13(11,19)14(15,16)17/h2-7,19H,1H3 |
| InChIKey | LULFEZCQYMKRQX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol?
The IUPAC name of 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol (CID 59492612) is 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol.
What is the SMILES notation for 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol?
The canonical SMILES for 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol is Cc1cnc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2.
What is the InChIKey of 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol?
The InChIKey is LULFEZCQYMKRQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3NO/c1-8-6-11-12(18-7-8)9-4-2-3-5-10(9)13(11,19)14(15,16)17/h2-7,19H,1H3.
What are the key properties of 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol?
3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol has a molecular weight of 265.23 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(trifluoromethyl)indeno[1,2-b]pyridin-5-ol is sourced from PubChem (CID 59492612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).