About 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol
2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol (PubChem CID 59492726) has the molecular formula C20H11Cl2F3O
and a molecular weight of 395.21 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol.
Molecular Properties
| Compound Name | 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol |
| PubChem CID | 59492726 |
| Molecular Formula | C20H11Cl2F3O |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol |
| SMILES | OC1(C(F)(F)F)c2ccccc2-c2ccc(-c3cc(Cl)cc(Cl)c3)cc21 |
| InChI | InChI=1S/C20H11Cl2F3O/c21-13-7-12(8-14(22)10-13)11-5-6-16-15-3-1-2-4-17(15)19(26,18(16)9-11)20(23,24)25/h1-10,26H |
| InChIKey | DYUWLNVAIQXQCC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol?
The IUPAC name of 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol (CID 59492726) is 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol.
What is the SMILES notation for 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol?
The canonical SMILES for 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol is OC1(C(F)(F)F)c2ccccc2-c2ccc(-c3cc(Cl)cc(Cl)c3)cc21.
What is the InChIKey of 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol?
The InChIKey is DYUWLNVAIQXQCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11Cl2F3O/c21-13-7-12(8-14(22)10-13)11-5-6-16-15-3-1-2-4-17(15)19(26,18(16)9-11)20(23,24)25/h1-10,26H.
What are the key properties of 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol?
2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol has a molecular weight of 395.21 g/mol, XLogP of 6.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dichlorophenyl)-9-(trifluoromethyl)fluoren-9-ol is sourced from PubChem (CID 59492726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).