C22H15ClF3NO2 — CID 59492770
2-chloro-4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-N-methylbenzamide (PubChem CID 59492770) has the molecular formula C22H15ClF3NO2 and a molecular weight of 417.81 g/mol. Its IUPAC name is 2-chloro-4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-N-methylbenzamide.
| Compound Name | 2-chloro-4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 59492770 |
| Molecular Formula | C22H15ClF3NO2 |
| Molecular Weight | 417.81 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-chloro-4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-c2ccc3c(c2)C(O)(C(F)(F)F)c2ccccc2-3)cc1Cl |
| InChI | InChI=1S/C22H15ClF3NO2/c1-27-20(28)16-9-7-13(11-19(16)23)12-6-8-15-14-4-2-3-5-17(14)21(29,18(15)10-12)22(24,25)26/h2-11,29H,1H3,(H,27,28) |
| InChIKey | VFBRTEJXNSQCHQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.81 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |