C19H16F3NO2 — CID 59492981
[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-(2-methylazetidin-1-yl)methanone (PubChem CID 59492981) has the molecular formula C19H16F3NO2 and a molecular weight of 347.34 g/mol. Its IUPAC name is [9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-(2-methylazetidin-1-yl)methanone.
| Compound Name | [9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-(2-methylazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 59492981 |
| Molecular Formula | C19H16F3NO2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]-(2-methylazetidin-1-yl)methanone |
| SMILES | CC1CCN1C(=O)c1ccc2c(c1)C(O)(C(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C19H16F3NO2/c1-11-8-9-23(11)17(24)12-6-7-14-13-4-2-3-5-15(13)18(25,16(14)10-12)19(20,21)22/h2-7,10-11,25H,8-9H2,1H3 |
| InChIKey | FIERJLCQXGOLMV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |