C24H23F3N2O4 — CID 59493001
4-[9-hydroxy-4-(1-propan-2-ylpyrazol-4-yl)-9-(trifluoromethyl)fluoren-2-yl]oxybutanoic acid (PubChem CID 59493001) has the molecular formula C24H23F3N2O4 and a molecular weight of 460.45 g/mol. Its IUPAC name is 4-[9-hydroxy-4-(1-propan-2-ylpyrazol-4-yl)-9-(trifluoromethyl)fluoren-2-yl]oxybutanoic acid.
| Compound Name | 4-[9-hydroxy-4-(1-propan-2-ylpyrazol-4-yl)-9-(trifluoromethyl)fluoren-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 59493001 |
| Molecular Formula | C24H23F3N2O4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-[9-hydroxy-4-(1-propan-2-ylpyrazol-4-yl)-9-(trifluoromethyl)fluoren-2-yl]oxybutanoic acid |
| SMILES | CC(C)n1cc(-c2cc(OCCCC(=O)O)cc3c2-c2ccccc2C3(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C24H23F3N2O4/c1-14(2)29-13-15(12-28-29)18-10-16(33-9-5-8-21(30)31)11-20-22(18)17-6-3-4-7-19(17)23(20,32)24(25,26)27/h3-4,6-7,10-14,32H,5,8-9H2,1-2H3,(H,30,31) |
| InChIKey | GSULHQXTWKFZBQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|