C22H23F3N2O3 — CID 59493107
propan-2-yl 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]piperazine-1-carboxylate (PubChem CID 59493107) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is propan-2-yl 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]piperazine-1-carboxylate.
| Compound Name | propan-2-yl 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59493107 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | propan-2-yl 4-[9-hydroxy-9-(trifluoromethyl)fluoren-2-yl]piperazine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCN(c2ccc3c(c2)C(O)(C(F)(F)F)c2ccccc2-3)CC1 |
| InChI | InChI=1S/C22H23F3N2O3/c1-14(2)30-20(28)27-11-9-26(10-12-27)15-7-8-17-16-5-3-4-6-18(16)21(29,19(17)13-15)22(23,24)25/h3-8,13-14,29H,9-12H2,1-2H3 |
| InChIKey | OXKLOXKYKSQJDQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |