C26H32N4O3 — CID 59494309
(2R)-N-cyclopropyl-N-[[1-(3-methoxypropyl)-4-phenylpyrrolo[2,3-b]pyridin-3-yl]methyl]morpholine-2-carboxamide (PubChem CID 59494309) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is (2R)-N-cyclopropyl-N-[[1-(3-methoxypropyl)-4-phenylpyrrolo[2,3-b]pyridin-3-yl]methyl]morpholine-2-carboxamide.
| Compound Name | (2R)-N-cyclopropyl-N-[[1-(3-methoxypropyl)-4-phenylpyrrolo[2,3-b]pyridin-3-yl]methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 59494309 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | (2R)-N-cyclopropyl-N-[[1-(3-methoxypropyl)-4-phenylpyrrolo[2,3-b]pyridin-3-yl]methyl]morpholine-2-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@H]2CNCCO2)C2CC2)c2c(-c3ccccc3)ccnc21 |
| InChI | InChI=1S/C26H32N4O3/c1-32-14-5-13-29-17-20(18-30(21-8-9-21)26(31)23-16-27-12-15-33-23)24-22(10-11-28-25(24)29)19-6-3-2-4-7-19/h2-4,6-7,10-11,17,21,23,27H,5,8-9,12-16,18H2,1H3/t23-/m1/s1 |
| InChIKey | QAFYKFAILNUYCZ-HSZRJFAPSA-N |
| XLogP | 3.22 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|