C20H25ClN4O2 — CID 59494683
N-[[4-chloro-3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(3-methoxypropyl)indazol-6-yl]methyl]cyclopropanamine (PubChem CID 59494683) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[[4-chloro-3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(3-methoxypropyl)indazol-6-yl]methyl]cyclopropanamine.
| Compound Name | N-[[4-chloro-3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(3-methoxypropyl)indazol-6-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 59494683 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[[4-chloro-3-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(3-methoxypropyl)indazol-6-yl]methyl]cyclopropanamine |
| SMILES | COCCCn1nc(-c2c(C)noc2C)c2c(Cl)cc(CNC3CC3)cc21 |
| InChI | InChI=1S/C20H25ClN4O2/c1-12-18(13(2)27-24-12)20-19-16(21)9-14(11-22-15-5-6-15)10-17(19)25(23-20)7-4-8-26-3/h9-10,15,22H,4-8,11H2,1-3H3 |
| InChIKey | WQWKUYBWEBHIPM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|