C13H13F3O3 — CID 59495448
ethyl 2-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-3,3,3-trifluoropropanoate (PubChem CID 59495448) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-3,3,3-trifluoropropanoate.
| Compound Name | ethyl 2-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 59495448 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethyl 2-(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)C(=C1C=C(C)C(=O)C(C)=C1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O3/c1-4-19-12(18)10(13(14,15)16)9-5-7(2)11(17)8(3)6-9/h5-6H,4H2,1-3H3 |
| InChIKey | HOEUEAMFYXDASU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|