C16H19N3O5 — CID 59496107
4-benzoyl-2-(3,3-dimethoxypropyl)-6-methyl-1,2,4-triazine-3,5-dione (PubChem CID 59496107) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-benzoyl-2-(3,3-dimethoxypropyl)-6-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 4-benzoyl-2-(3,3-dimethoxypropyl)-6-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 59496107 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 4-benzoyl-2-(3,3-dimethoxypropyl)-6-methyl-1,2,4-triazine-3,5-dione |
| SMILES | COC(CCn1nc(C)c(=O)n(C(=O)c2ccccc2)c1=O)OC |
| InChI | InChI=1S/C16H19N3O5/c1-11-14(20)19(15(21)12-7-5-4-6-8-12)16(22)18(17-11)10-9-13(23-2)24-3/h4-8,13H,9-10H2,1-3H3 |
| InChIKey | FDEUZCDDHMDVKS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 92.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|