C18H18F3N3O2 — CID 59496251
3-amino-N-[[4-[2-(trifluoromethyl)anilino]phenyl]methyl]oxetane-3-carboxamide (PubChem CID 59496251) has the molecular formula C18H18F3N3O2 and a molecular weight of 365.36 g/mol. Its IUPAC name is 3-amino-N-[[4-[2-(trifluoromethyl)anilino]phenyl]methyl]oxetane-3-carboxamide.
| Compound Name | 3-amino-N-[[4-[2-(trifluoromethyl)anilino]phenyl]methyl]oxetane-3-carboxamide |
|---|---|
| PubChem CID | 59496251 |
| Molecular Formula | C18H18F3N3O2 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 3-amino-N-[[4-[2-(trifluoromethyl)anilino]phenyl]methyl]oxetane-3-carboxamide |
| SMILES | NC1(C(=O)NCc2ccc(Nc3ccccc3C(F)(F)F)cc2)COC1 |
| InChI | InChI=1S/C18H18F3N3O2/c19-18(20,21)14-3-1-2-4-15(14)24-13-7-5-12(6-8-13)9-23-16(25)17(22)10-26-11-17/h1-8,24H,9-11,22H2,(H,23,25) |
| InChIKey | MGGBZWUZKOBADF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |