1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid

C8H8N2O3S — CID 59496322

IUPAC1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid
SMILESO=C(NC1(C(=O)O)CC1)c1cncs1
InChIInChI=1S/C8H8N2O3S/c11-6(5-3-9-4-14-5)10-8(1-2-8)7(12)13/h3-4H,1-2H2,(H,10,11)(H,12,13)
InChIKeyDJZSMUFGHIALMO-UHFFFAOYSA-N
MW212.23 g/mol
LogP0.49
Rot. Bonds3

About 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid

1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid (PubChem CID 59496322) has the molecular formula C8H8N2O3S and a molecular weight of 212.23 g/mol. Its IUPAC name is 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid
PubChem CID59496322
Molecular FormulaC8H8N2O3S
Molecular Weight212.23 g/mol
Exact Mass212.03
IUPAC Name1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid
SMILESO=C(NC1(C(=O)O)CC1)c1cncs1
InChIInChI=1S/C8H8N2O3S/c11-6(5-3-9-4-14-5)10-8(1-2-8)7(12)13/h3-4H,1-2H2,(H,10,11)(H,12,13)
InChIKeyDJZSMUFGHIALMO-UHFFFAOYSA-N
XLogP0.49
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.23
LogP ≤ 50.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid?
The IUPAC name of 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid (CID 59496322) is 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid.
What is the SMILES notation for 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid?
The canonical SMILES for 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid is O=C(NC1(C(=O)O)CC1)c1cncs1.
What is the InChIKey of 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid?
The InChIKey is DJZSMUFGHIALMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S/c11-6(5-3-9-4-14-5)10-8(1-2-8)7(12)13/h3-4H,1-2H2,(H,10,11)(H,12,13).
What are the key properties of 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid?
1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid has a molecular weight of 212.23 g/mol, XLogP of 0.49, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-thiazole-5-carbonylamino)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 59496322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).