C31H34N4O6S — CID 59497210
(1S,4R,6R,7Z,18R)-18-[7-methoxy-2-(1,3-thiazol-4-yl)quinolin-4-yl]oxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylic acid (PubChem CID 59497210) has the molecular formula C31H34N4O6S and a molecular weight of 590.70 g/mol. Its IUPAC name is (1S,4R,6R,7Z,18R)-18-[7-methoxy-2-(1,3-thiazol-4-yl)quinolin-4-yl]oxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylic acid.
| Compound Name | (1S,4R,6R,7Z,18R)-18-[7-methoxy-2-(1,3-thiazol-4-yl)quinolin-4-yl]oxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 59497210 |
| Molecular Formula | C31H34N4O6S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | (1S,4R,6R,7Z,18R)-18-[7-methoxy-2-(1,3-thiazol-4-yl)quinolin-4-yl]oxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxylic acid |
| SMILES | COc1ccc2c(O[C@@H]3C[C@H]4C(=O)N[C@]5(C(=O)O)C[C@@H]5/C=C\CCCCCCC(=O)N4C3)cc(-c3cscn3)nc2c1 |
| InChI | InChI=1S/C31H34N4O6S/c1-40-20-10-11-22-23(12-20)33-24(25-17-42-18-32-25)14-27(22)41-21-13-26-29(37)34-31(30(38)39)15-19(31)8-6-4-2-3-5-7-9-28(36)35(26)16-21/h6,8,10-12,14,17-19,21,26H,2-5,7,9,13,15-16H2,1H3,(H,34,37)(H,38,39)/b8-6-/t19-,21+,26-,31+/m0/s1 |
| InChIKey | RSZGSEQLBSKRNY-PURYEXHVSA-N |
| XLogP | 4.59 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|