C23H35NO5 — CID 59497214
trans-ethyl (1R,2S)-2-ethenyl-1-[2-[(2S,4S)-4-hydroxy-1-non-8-enoylpyrrolidin-2-yl]-2-oxoethyl]cyclopropane-1-carboxylate (PubChem CID 59497214) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is trans-ethyl (1R,2S)-2-ethenyl-1-[2-[(2S,4S)-4-hydroxy-1-non-8-enoylpyrrolidin-2-yl]-2-oxoethyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2S)-2-ethenyl-1-[2-[(2S,4S)-4-hydroxy-1-non-8-enoylpyrrolidin-2-yl]-2-oxoethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 59497214 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | trans-ethyl (1R,2S)-2-ethenyl-1-[2-[(2S,4S)-4-hydroxy-1-non-8-enoylpyrrolidin-2-yl]-2-oxoethyl]cyclopropane-1-carboxylate |
| SMILES | C=CCCCCCCC(=O)N1C[C@@H](O)C[C@H]1C(=O)C[C@]1(C(=O)OCC)C[C@H]1C=C |
| InChI | InChI=1S/C23H35NO5/c1-4-7-8-9-10-11-12-21(27)24-16-18(25)13-19(24)20(26)15-23(14-17(23)5-2)22(28)29-6-3/h4-5,17-19,25H,1-2,6-16H2,3H3/t17-,18+,19+,23-/m1/s1 |
| InChIKey | JJYZKXNTDVUVDF-GKAYAJSDSA-N |
| XLogP | 3.19 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|