About 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid
2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid (PubChem CID 59497629) has the molecular formula C25H29N3O4
and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid.
Molecular Properties
| Compound Name | 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid |
| PubChem CID | 59497629 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid |
| SMILES | CCCC(O)C(Cn1c(=O)n(Cc2cn(C)c3cccc(C)c23)c2ccccc21)C(=O)O |
| InChI | InChI=1S/C25H29N3O4/c1-4-8-22(29)18(24(30)31)15-28-20-11-6-5-10-19(20)27(25(28)32)14-17-13-26(3)21-12-7-9-16(2)23(17)21/h5-7,9-13,18,22,29H,4,8,14-15H2,1-3H3,(H,30,31) |
| InChIKey | XDQHASQHYATYHC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid?
The IUPAC name of 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid (CID 59497629) is 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid.
What is the SMILES notation for 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid?
The canonical SMILES for 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid is CCCC(O)C(Cn1c(=O)n(Cc2cn(C)c3cccc(C)c23)c2ccccc21)C(=O)O.
What is the InChIKey of 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid?
The InChIKey is XDQHASQHYATYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O4/c1-4-8-22(29)18(24(30)31)15-28-20-11-6-5-10-19(20)27(25(28)32)14-17-13-26(3)21-12-7-9-16(2)23(17)21/h5-7,9-13,18,22,29H,4,8,14-15H2,1-3H3,(H,30,31).
What are the key properties of 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid?
2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid has a molecular weight of 435.52 g/mol, XLogP of 3.51, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-[(1,4-dimethylindol-3-yl)methyl]-2-oxobenzimidazol-1-yl]methyl]-3-hydroxyhexanoic acid is sourced from PubChem (CID 59497629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).