C23H30O2S — CID 59497931
(E)-1-[3,4-bis(2-methylpropyl)thiophen-2-yl]-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 59497931) has the molecular formula C23H30O2S and a molecular weight of 370.56 g/mol. Its IUPAC name is (E)-1-[3,4-bis(2-methylpropyl)thiophen-2-yl]-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[3,4-bis(2-methylpropyl)thiophen-2-yl]-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59497931 |
| Molecular Formula | C23H30O2S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (E)-1-[3,4-bis(2-methylpropyl)thiophen-2-yl]-3-(4-hydroxy-3,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1cc(/C=C/C(=O)c2scc(CC(C)C)c2CC(C)C)cc(C)c1O |
| InChI | InChI=1S/C23H30O2S/c1-14(2)9-19-13-26-23(20(19)10-15(3)4)21(24)8-7-18-11-16(5)22(25)17(6)12-18/h7-8,11-15,25H,9-10H2,1-6H3/b8-7+ |
| InChIKey | ROYQOOLGXBKRQV-BQYQJAHWSA-N |
| XLogP | 6.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|