About phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate
phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate (PubChem CID 59498141) has the molecular formula C25H23NO2
and a molecular weight of 369.46 g/mol. Its IUPAC name is phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate.
Molecular Properties
| Compound Name | phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate |
| PubChem CID | 59498141 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate |
| SMILES | CC(=C\Oc1ccccc1)/C(=N/c1ccc2c(c1)CCC2)Oc1ccccc1 |
| InChI | InChI=1S/C25H23NO2/c1-19(18-27-23-11-4-2-5-12-23)25(28-24-13-6-3-7-14-24)26-22-16-15-20-9-8-10-21(20)17-22/h2-7,11-18H,8-10H2,1H3/b19-18+,26-25- |
| InChIKey | CYMUXBPFHUEFNE-RZKVMXFESA-N |
| XLogP | 6.27 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate?
The IUPAC name of phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate (CID 59498141) is phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate.
What is the SMILES notation for phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate?
The canonical SMILES for phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate is CC(=C\Oc1ccccc1)/C(=N/c1ccc2c(c1)CCC2)Oc1ccccc1.
What is the InChIKey of phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate?
The InChIKey is CYMUXBPFHUEFNE-RZKVMXFESA-N. The full InChI is InChI=1S/C25H23NO2/c1-19(18-27-23-11-4-2-5-12-23)25(28-24-13-6-3-7-14-24)26-22-16-15-20-9-8-10-21(20)17-22/h2-7,11-18H,8-10H2,1H3/b19-18+,26-25-.
What are the key properties of phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate?
phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate has a molecular weight of 369.46 g/mol, XLogP of 6.27, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl (E)-N-(2,3-dihydro-1H-inden-5-yl)-2-methyl-3-phenoxyprop-2-enimidate is sourced from PubChem (CID 59498141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).