About (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate
(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate (PubChem CID 59498648) has the molecular formula C17H23N3O5
and a molecular weight of 349.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate |
| PubChem CID | 59498648 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate |
| SMILES | C#CCNC(CC(C)(C)C(=O)ON1C(=O)CCC1=O)N1CCCC1=O |
| InChI | InChI=1S/C17H23N3O5/c1-4-9-18-12(19-10-5-6-13(19)21)11-17(2,3)16(24)25-20-14(22)7-8-15(20)23/h1,12,18H,5-11H2,2-3H3 |
| InChIKey | DXZHTKQVMSMGMT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate (CID 59498648) is (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate is C#CCNC(CC(C)(C)C(=O)ON1C(=O)CCC1=O)N1CCCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate?
The InChIKey is DXZHTKQVMSMGMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O5/c1-4-9-18-12(19-10-5-6-13(19)21)11-17(2,3)16(24)25-20-14(22)7-8-15(20)23/h1,12,18H,5-11H2,2-3H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate?
(2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate has a molecular weight of 349.39 g/mol, XLogP of 0.18, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-4-(prop-2-ynylamino)butanoate is sourced from PubChem (CID 59498648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).