C28H15NO6 — CID 59499662
5-[5-(2-naphthalen-1-ylethynyl)-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid (PubChem CID 59499662) has the molecular formula C28H15NO6 and a molecular weight of 461.43 g/mol. Its IUPAC name is 5-[5-(2-naphthalen-1-ylethynyl)-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[5-(2-naphthalen-1-ylethynyl)-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 59499662 |
| Molecular Formula | C28H15NO6 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 5-[5-(2-naphthalen-1-ylethynyl)-1,3-dioxoisoindol-2-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(N2C(=O)c3ccc(C#Cc4cccc5ccccc45)cc3C2=O)c1 |
| InChI | InChI=1S/C28H15NO6/c30-25-23-11-9-16(8-10-18-6-3-5-17-4-1-2-7-22(17)18)12-24(23)26(31)29(25)21-14-19(27(32)33)13-20(15-21)28(34)35/h1-7,9,11-15H,(H,32,33)(H,34,35) |
| InChIKey | FDKNQDYODIKASX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|