C44H30N4 — CID 59500053
9-[4-[3,5-bis(4-phenylphenyl)-1,2,4-triazol-1-yl]phenyl]carbazole (PubChem CID 59500053) has the molecular formula C44H30N4 and a molecular weight of 614.75 g/mol. Its IUPAC name is 9-[4-[3,5-bis(4-phenylphenyl)-1,2,4-triazol-1-yl]phenyl]carbazole.
| Compound Name | 9-[4-[3,5-bis(4-phenylphenyl)-1,2,4-triazol-1-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 59500053 |
| Molecular Formula | C44H30N4 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 9-[4-[3,5-bis(4-phenylphenyl)-1,2,4-triazol-1-yl]phenyl]carbazole |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)n(-c4ccc(-n5c6ccccc6c6ccccc65)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C44H30N4/c1-3-11-31(12-4-1)33-19-23-35(24-20-33)43-45-44(36-25-21-34(22-26-36)32-13-5-2-6-14-32)48(46-43)38-29-27-37(28-30-38)47-41-17-9-7-15-39(41)40-16-8-10-18-42(40)47/h1-30H |
| InChIKey | WRHDJTJEUWQUPI-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |