About 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole
5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole (PubChem CID 59500118) has the molecular formula C32H30Si
and a molecular weight of 442.68 g/mol. Its IUPAC name is 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole.
Molecular Properties
| Compound Name | 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole |
| PubChem CID | 59500118 |
| Molecular Formula | C32H30Si |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole |
| SMILES | Cc1ccc(/C=C/c2ccc3c(c2)[Si](C)(C)c2cc(/C=C/c4ccc(C)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C32H30Si/c1-23-5-9-25(10-6-23)13-15-27-17-19-29-30-20-18-28(16-14-26-11-7-24(2)8-12-26)22-32(30)33(3,4)31(29)21-27/h5-22H,1-4H3/b15-13+,16-14+ |
| InChIKey | LIMQWMMKUFERSV-WXUKJITCSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole?
The IUPAC name of 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole (CID 59500118) is 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole.
What is the SMILES notation for 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole?
The canonical SMILES for 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole is Cc1ccc(/C=C/c2ccc3c(c2)[Si](C)(C)c2cc(/C=C/c4ccc(C)cc4)ccc2-3)cc1.
What is the InChIKey of 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole?
The InChIKey is LIMQWMMKUFERSV-WXUKJITCSA-N. The full InChI is InChI=1S/C32H30Si/c1-23-5-9-25(10-6-23)13-15-27-17-19-29-30-20-18-28(16-14-26-11-7-24(2)8-12-26)22-32(30)33(3,4)31(29)21-27/h5-22H,1-4H3/b15-13+,16-14+.
What are the key properties of 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole?
5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole has a molecular weight of 442.68 g/mol, XLogP of 7.45, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-3,7-bis[(E)-2-(4-methylphenyl)ethenyl]benzo[b][1]benzosilole is sourced from PubChem (CID 59500118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).