About 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole
4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole (PubChem CID 59500331) has the molecular formula C30H18N6O
and a molecular weight of 478.52 g/mol. Its IUPAC name is 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole.
Molecular Properties
| Compound Name | 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole |
| PubChem CID | 59500331 |
| Molecular Formula | C30H18N6O |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole |
| SMILES | c1ccc2c(c1)n(-c1ccc3c(c1)oc1cc(-n4c5ccccc5n5nccc45)ccc13)c1ccnn21 |
| InChI | InChI=1S/C30H18N6O/c1-3-7-25-23(5-1)33(29-13-15-31-35(25)29)19-9-11-21-22-12-10-20(18-28(22)37-27(21)17-19)34-24-6-2-4-8-26(24)36-30(34)14-16-32-36/h1-18H |
| InChIKey | CVURLVZEYWAALA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 57.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole?
The IUPAC name of 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole (CID 59500331) is 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole.
What is the SMILES notation for 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole?
The canonical SMILES for 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole is c1ccc2c(c1)n(-c1ccc3c(c1)oc1cc(-n4c5ccccc5n5nccc45)ccc13)c1ccnn21.
What is the InChIKey of 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole?
The InChIKey is CVURLVZEYWAALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H18N6O/c1-3-7-25-23(5-1)33(29-13-15-31-35(25)29)19-9-11-21-22-12-10-20(18-28(22)37-27(21)17-19)34-24-6-2-4-8-26(24)36-30(34)14-16-32-36/h1-18H.
What are the key properties of 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole?
4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole has a molecular weight of 478.52 g/mol, XLogP of 6.77, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-pyrazolo[1,5-a]benzimidazol-4-yldibenzofuran-3-yl)pyrazolo[1,5-a]benzimidazole is sourced from PubChem (CID 59500331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).