C12H11F3N4 — CID 59500341
7-propan-2-yl-4-(trifluoromethyl)-2,3,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene (PubChem CID 59500341) has the molecular formula C12H11F3N4 and a molecular weight of 268.24 g/mol. Its IUPAC name is 7-propan-2-yl-4-(trifluoromethyl)-2,3,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene.
| Compound Name | 7-propan-2-yl-4-(trifluoromethyl)-2,3,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
|---|---|
| PubChem CID | 59500341 |
| Molecular Formula | C12H11F3N4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 7-propan-2-yl-4-(trifluoromethyl)-2,3,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),3,5,9,11-pentaene |
| SMILES | CC(C)n1c2cccnc2n2nc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C12H11F3N4/c1-7(2)18-8-4-3-5-16-11(8)19-10(18)6-9(17-19)12(13,14)15/h3-7H,1-2H3 |
| InChIKey | BSKRDIMBDXHDQK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |