About lithium 2-methyl-5-phenyl-1,3,4-oxadiazole
lithium 2-methyl-5-phenyl-1,3,4-oxadiazole (PubChem CID 59501365) has the molecular formula C9H7LiN2O
and a molecular weight of 166.11 g/mol. Its IUPAC name is lithium 2-methyl-5-phenyl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | lithium 2-methyl-5-phenyl-1,3,4-oxadiazole |
| PubChem CID | 59501365 |
| Molecular Formula | C9H7LiN2O |
| Molecular Weight | 166.11 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | lithium 2-methyl-5-phenyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2cc[c-]cc2)o1.[Li+] |
| InChI | InChI=1S/C9H7N2O.Li/c1-7-10-11-9(12-7)8-5-3-2-4-6-8;/h3-6H,1H3;/q-1;+1 |
| InChIKey | LRPHTWPVIGYIEH-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.11 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-methyl-5-phenyl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-methyl-5-phenyl-1,3,4-oxadiazole?
The IUPAC name of lithium 2-methyl-5-phenyl-1,3,4-oxadiazole (CID 59501365) is lithium 2-methyl-5-phenyl-1,3,4-oxadiazole.
What is the SMILES notation for lithium 2-methyl-5-phenyl-1,3,4-oxadiazole?
The canonical SMILES for lithium 2-methyl-5-phenyl-1,3,4-oxadiazole is Cc1nnc(-c2cc[c-]cc2)o1.[Li+].
What is the InChIKey of lithium 2-methyl-5-phenyl-1,3,4-oxadiazole?
The InChIKey is LRPHTWPVIGYIEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N2O.Li/c1-7-10-11-9(12-7)8-5-3-2-4-6-8;/h3-6H,1H3;/q-1;+1.
What are the key properties of lithium 2-methyl-5-phenyl-1,3,4-oxadiazole?
lithium 2-methyl-5-phenyl-1,3,4-oxadiazole has a molecular weight of 166.11 g/mol, XLogP of -1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-methyl-5-phenyl-1,3,4-oxadiazole is sourced from PubChem (CID 59501365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).