About 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole
2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole (PubChem CID 59501381) has the molecular formula C32H20N4O
and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole |
| PubChem CID | 59501381 |
| Molecular Formula | C32H20N4O |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2nnc(-c3ccc(-c4c5ccccc5c(-c5ccncn5)c5ccccc45)cc3)o2)cc1 |
| InChI | InChI=1S/C32H20N4O/c1-2-8-22(9-3-1)31-35-36-32(37-31)23-16-14-21(15-17-23)29-24-10-4-6-12-26(24)30(28-18-19-33-20-34-28)27-13-7-5-11-25(27)29/h1-20H |
| InChIKey | FMTAKWAJUFLKDU-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole?
The IUPAC name of 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole (CID 59501381) is 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole.
What is the SMILES notation for 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole?
The canonical SMILES for 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole is c1ccc(-c2nnc(-c3ccc(-c4c5ccccc5c(-c5ccncn5)c5ccccc45)cc3)o2)cc1.
What is the InChIKey of 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole?
The InChIKey is FMTAKWAJUFLKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H20N4O/c1-2-8-22(9-3-1)31-35-36-32(37-31)23-16-14-21(15-17-23)29-24-10-4-6-12-26(24)30(28-18-19-33-20-34-28)27-13-7-5-11-25(27)29/h1-20H.
What are the key properties of 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole?
2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole has a molecular weight of 476.54 g/mol, XLogP of 7.83, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5-[4-(10-pyrimidin-4-ylanthracen-9-yl)phenyl]-1,3,4-oxadiazole is sourced from PubChem (CID 59501381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).