About iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline
iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline (PubChem CID 59501555) has the molecular formula C22H21IrN4O2-
and a molecular weight of 565.65 g/mol. Its IUPAC name is iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline.
Molecular Properties
| Compound Name | iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline |
| PubChem CID | 59501555 |
| Molecular Formula | C22H21IrN4O2- |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline |
| SMILES | Cc1cc2nc(C)c(-c3[c-]cccc3)nc2cc1C.Cn1ccc(C(=O)O)n1.[Ir] |
| InChI | InChI=1S/C17H15N2.C5H6N2O2.Ir/c1-11-9-15-16(10-12(11)2)19-17(13(3)18-15)14-7-5-4-6-8-14;1-7-3-2-4(6-7)5(8)9;/h4-7,9-10H,1-3H3;2-3H,1H3,(H,8,9);/q-1;; |
| InChIKey | SBTIMKCYTORYPR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline?
The IUPAC name of iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline (CID 59501555) is iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline.
What is the SMILES notation for iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline?
The canonical SMILES for iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline is Cc1cc2nc(C)c(-c3[c-]cccc3)nc2cc1C.Cn1ccc(C(=O)O)n1.[Ir].
What is the InChIKey of iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline?
The InChIKey is SBTIMKCYTORYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N2.C5H6N2O2.Ir/c1-11-9-15-16(10-12(11)2)19-17(13(3)18-15)14-7-5-4-6-8-14;1-7-3-2-4(6-7)5(8)9;/h4-7,9-10H,1-3H3;2-3H,1H3,(H,8,9);/q-1;;.
What are the key properties of iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline?
iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline has a molecular weight of 565.65 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-methylpyrazole-3-carboxylic acid;2,6,7-trimethyl-3-phenylquinoxaline is sourced from PubChem (CID 59501555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).