C30H36O12 — CID 59501804
[(2R,4aR,6S,7R,8S,8aR)-7,8-diacetyloxy-2-(4-methylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 4-[2-(2-methoxyethoxy)ethoxy]benzoate (PubChem CID 59501804) has the molecular formula C30H36O12 and a molecular weight of 588.61 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-7,8-diacetyloxy-2-(4-methylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 4-[2-(2-methoxyethoxy)ethoxy]benzoate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-7,8-diacetyloxy-2-(4-methylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 4-[2-(2-methoxyethoxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 59501804 |
| Molecular Formula | C30H36O12 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-7,8-diacetyloxy-2-(4-methylphenyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] 4-[2-(2-methoxyethoxy)ethoxy]benzoate |
| SMILES | COCCOCCOc1ccc(C(=O)O[C@@H]2O[C@@H]3CO[C@@H](c4ccc(C)cc4)O[C@H]3[C@H](OC(C)=O)[C@H]2OC(C)=O)cc1 |
| InChI | InChI=1S/C30H36O12/c1-18-5-7-22(8-6-18)29-37-17-24-25(41-29)26(38-19(2)31)27(39-20(3)32)30(40-24)42-28(33)21-9-11-23(12-10-21)36-16-15-35-14-13-34-4/h5-12,24-27,29-30H,13-17H2,1-4H3/t24-,25-,26+,27-,29-,30+/m1/s1 |
| InChIKey | ZHOVZUIXCKHWDF-MEENACTQSA-N |
| XLogP | 2.90 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|