About 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium)
1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium) (PubChem CID 59501817) has the molecular formula C23H35Y2-
and a molecular weight of 489.35 g/mol. Its IUPAC name is 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium).
Molecular Properties
| Compound Name | 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium) |
| PubChem CID | 59501817 |
| Molecular Formula | C23H35Y2- |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium) |
| SMILES | [CH2-]C1CCC(Cc2ccc(CC3CCC(CC)CC3)cc2)CC1.[Y].[Y] |
| InChI | InChI=1S/C23H35.2Y/c1-3-19-8-10-21(11-9-19)17-23-14-12-22(13-15-23)16-20-6-4-18(2)5-7-20;;/h12-15,18-21H,2-11,16-17H2,1H3;;/q-1;; |
| InChIKey | RDWKRDPPHNTBMS-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium)?
The IUPAC name of 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium) (CID 59501817) is 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium).
What is the SMILES notation for 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium)?
The canonical SMILES for 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium) is [CH2-]C1CCC(Cc2ccc(CC3CCC(CC)CC3)cc2)CC1.[Y].[Y].
What is the InChIKey of 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium)?
The InChIKey is RDWKRDPPHNTBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H35.2Y/c1-3-19-8-10-21(11-9-19)17-23-14-12-22(13-15-23)16-20-6-4-18(2)5-7-20;;/h12-15,18-21H,2-11,16-17H2,1H3;;/q-1;;.
What are the key properties of 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium)?
1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium) has a molecular weight of 489.35 g/mol, XLogP of 6.62, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-ethylcyclohexyl)methyl]-4-[(4-methanidylcyclohexyl)methyl]benzene;bis(yttrium) is sourced from PubChem (CID 59501817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).