About [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate
[2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate (PubChem CID 59501872) has the molecular formula C18H16N2O4S2
and a molecular weight of 388.47 g/mol. Its IUPAC name is [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate |
| PubChem CID | 59501872 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate |
| SMILES | [C-]#[N+]C(C#N)=C1Sc2c(OC(=O)C(C)C)ccc(OC(=O)C(C)C)c2S1 |
| InChI | InChI=1S/C18H16N2O4S2/c1-9(2)16(21)23-12-6-7-13(24-17(22)10(3)4)15-14(12)25-18(26-15)11(8-19)20-5/h6-7,9-10H,1-4H3 |
| InChIKey | UVBNNEKHQSVZSU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate?
The IUPAC name of [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate (CID 59501872) is [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate.
What is the SMILES notation for [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate?
The canonical SMILES for [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate is [C-]#[N+]C(C#N)=C1Sc2c(OC(=O)C(C)C)ccc(OC(=O)C(C)C)c2S1.
What is the InChIKey of [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate?
The InChIKey is UVBNNEKHQSVZSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4S2/c1-9(2)16(21)23-12-6-7-13(24-17(22)10(3)4)15-14(12)25-18(26-15)11(8-19)20-5/h6-7,9-10H,1-4H3.
What are the key properties of [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate?
[2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate has a molecular weight of 388.47 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[cyano(isocyano)methylidene]-4-(2-methylpropanoyloxy)-1,3-benzodithiol-7-yl] 2-methylpropanoate is sourced from PubChem (CID 59501872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).