C29H24O7 — CID 59502054
(4bR,5R,9bR,10R)-10-(3,4-dihydroxyphenyl)-5-(3-hydroxy-4-methylphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-1,3,6,8-tetrol (PubChem CID 59502054) has the molecular formula C29H24O7 and a molecular weight of 484.50 g/mol. Its IUPAC name is (4bR,5R,9bR,10R)-10-(3,4-dihydroxyphenyl)-5-(3-hydroxy-4-methylphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-1,3,6,8-tetrol.
| Compound Name | (4bR,5R,9bR,10R)-10-(3,4-dihydroxyphenyl)-5-(3-hydroxy-4-methylphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-1,3,6,8-tetrol |
|---|---|
| PubChem CID | 59502054 |
| Molecular Formula | C29H24O7 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | (4bR,5R,9bR,10R)-10-(3,4-dihydroxyphenyl)-5-(3-hydroxy-4-methylphenyl)-4b,5,9b,10-tetrahydroindeno[2,1-a]indene-1,3,6,8-tetrol |
| SMILES | Cc1ccc([C@@H]2c3c(O)cc(O)cc3[C@H]3[C@H](c4ccc(O)c(O)c4)c4c(O)cc(O)cc4[C@@H]23)cc1O |
| InChI | InChI=1S/C29H24O7/c1-12-2-3-13(6-20(12)33)24-26-17(8-15(30)10-22(26)35)29-25(14-4-5-19(32)21(34)7-14)27-18(28(24)29)9-16(31)11-23(27)36/h2-11,24-25,28-36H,1H3/t24-,25-,28+,29+/m1/s1 |
| InChIKey | UNAZDUQNSKRHAG-RZCBTRPQSA-N |
| XLogP | 5.09 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|