About (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol
(4-methoxycyclohexa-2,4-dien-1-yl)methanethiol (PubChem CID 59502089) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol.
Molecular Properties
| Compound Name | (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol |
| PubChem CID | 59502089 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol |
| SMILES | COC1=CCC(CS)C=C1 |
| InChI | InChI=1S/C8H12OS/c1-9-8-4-2-7(6-10)3-5-8/h2,4-5,7,10H,3,6H2,1H3 |
| InChIKey | NDTWKUCQZCXCCV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol?
The IUPAC name of (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol (CID 59502089) is (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol.
What is the SMILES notation for (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol?
The canonical SMILES for (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol is COC1=CCC(CS)C=C1.
What is the InChIKey of (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol?
The InChIKey is NDTWKUCQZCXCCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS/c1-9-8-4-2-7(6-10)3-5-8/h2,4-5,7,10H,3,6H2,1H3.
What are the key properties of (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol?
(4-methoxycyclohexa-2,4-dien-1-yl)methanethiol has a molecular weight of 156.25 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycyclohexa-2,4-dien-1-yl)methanethiol is sourced from PubChem (CID 59502089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).