About 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane
6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane (PubChem CID 59502481) has the molecular formula C13H20O6
and a molecular weight of 272.30 g/mol. Its IUPAC name is 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane.
Molecular Properties
| Compound Name | 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane |
| PubChem CID | 59502481 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane |
| SMILES | C(COCC1CO1)OCCOC1CC2OC1C1OC21 |
| InChI | InChI=1S/C13H20O6/c1(2-15-6-8-7-17-8)14-3-4-16-9-5-10-12-13(19-12)11(9)18-10/h8-13H,1-7H2 |
| InChIKey | XCWUYLGLPOEICE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane?
The IUPAC name of 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane (CID 59502481) is 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane.
What is the SMILES notation for 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane?
The canonical SMILES for 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane is C(COCC1CO1)OCCOC1CC2OC1C1OC21.
What is the InChIKey of 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane?
The InChIKey is XCWUYLGLPOEICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O6/c1(2-15-6-8-7-17-8)14-3-4-16-9-5-10-12-13(19-12)11(9)18-10/h8-13H,1-7H2.
What are the key properties of 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane?
6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane has a molecular weight of 272.30 g/mol, XLogP of -0.26, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[2-(oxiran-2-ylmethoxy)ethoxy]ethoxy]-3,8-dioxatricyclo[3.2.1.02,4]octane is sourced from PubChem (CID 59502481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).