About 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one
9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one (PubChem CID 59502539) has the molecular formula C21H9Cl2FOS
and a molecular weight of 399.27 g/mol. Its IUPAC name is 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one.
Molecular Properties
| Compound Name | 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one |
| PubChem CID | 59502539 |
| Molecular Formula | C21H9Cl2FOS |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one |
| SMILES | O=c1c2cc(F)ccc2sc2cc3cc4cc(Cl)c(Cl)cc4cc3cc12 |
| InChI | InChI=1S/C21H9Cl2FOS/c22-17-6-11-3-10-5-15-20(8-13(10)4-12(11)7-18(17)23)26-19-2-1-14(24)9-16(19)21(15)25/h1-9H |
| InChIKey | YSXIXMZNFLESCL-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one?
The IUPAC name of 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one (CID 59502539) is 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one.
What is the SMILES notation for 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one?
The canonical SMILES for 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one is O=c1c2cc(F)ccc2sc2cc3cc4cc(Cl)c(Cl)cc4cc3cc12.
What is the InChIKey of 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one?
The InChIKey is YSXIXMZNFLESCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H9Cl2FOS/c22-17-6-11-3-10-5-15-20(8-13(10)4-12(11)7-18(17)23)26-19-2-1-14(24)9-16(19)21(15)25/h1-9H.
What are the key properties of 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one?
9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one has a molecular weight of 399.27 g/mol, XLogP of 7.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-dichloro-2-fluoronaphtho[2,3-b]thioxanthen-14-one is sourced from PubChem (CID 59502539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).