About N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide
N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide (PubChem CID 59502593) has the molecular formula C16H16F6N2O
and a molecular weight of 366.31 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide |
| PubChem CID | 59502593 |
| Molecular Formula | C16H16F6N2O |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide |
| SMILES | CCC(C)C(=O)N(CCC#N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F6N2O/c1-3-10(2)14(25)24(6-4-5-23)13-8-11(15(17,18)19)7-12(9-13)16(20,21)22/h7-10H,3-4,6H2,1-2H3 |
| InChIKey | LYXYQTPXXYCFAH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide (CID 59502593) is N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide is CCC(C)C(=O)N(CCC#N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide?
The InChIKey is LYXYQTPXXYCFAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F6N2O/c1-3-10(2)14(25)24(6-4-5-23)13-8-11(15(17,18)19)7-12(9-13)16(20,21)22/h7-10H,3-4,6H2,1-2H3.
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide?
N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide has a molecular weight of 366.31 g/mol, XLogP of 5.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-N-(2-cyanoethyl)-2-methylbutanamide is sourced from PubChem (CID 59502593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).