About 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane
4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane (PubChem CID 59502954) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane.
Molecular Properties
| Compound Name | 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane |
| PubChem CID | 59502954 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane |
| SMILES | CC1CC2NC1C1C3CCC(CC3)C21 |
| InChI | InChI=1S/C13H21N/c1-7-6-10-11-8-2-4-9(5-3-8)12(11)13(7)14-10/h7-14H,2-6H2,1H3 |
| InChIKey | QFQNQUYUNNVASK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane?
The IUPAC name of 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane (CID 59502954) is 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane.
What is the SMILES notation for 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane?
The canonical SMILES for 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane is CC1CC2NC1C1C3CCC(CC3)C21.
What is the InChIKey of 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane?
The InChIKey is QFQNQUYUNNVASK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-7-6-10-11-8-2-4-9(5-3-8)12(11)13(7)14-10/h7-14H,2-6H2,1H3.
What are the key properties of 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane?
4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane has a molecular weight of 191.32 g/mol, XLogP of 2.42, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-13-azatetracyclo[6.2.2.13,6.02,7]tridecane is sourced from PubChem (CID 59502954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).