About (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate
(2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 59502978) has the molecular formula C11H15F3O4
and a molecular weight of 268.23 g/mol. Its IUPAC name is (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate.
Molecular Properties
| Compound Name | (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate |
| PubChem CID | 59502978 |
| Molecular Formula | C11H15F3O4 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1CCCOC1=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O4/c1-3-10(2,11(12,13)14)9(16)18-7-5-4-6-17-8(7)15/h7H,3-6H2,1-2H3 |
| InChIKey | HOHTYUMQGBQAAU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The IUPAC name of (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate (CID 59502978) is (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate.
What is the SMILES notation for (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The canonical SMILES for (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate is CCC(C)(C(=O)OC1CCCOC1=O)C(F)(F)F.
What is the InChIKey of (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate?
The InChIKey is HOHTYUMQGBQAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3O4/c1-3-10(2,11(12,13)14)9(16)18-7-5-4-6-17-8(7)15/h7H,3-6H2,1-2H3.
What are the key properties of (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate?
(2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate has a molecular weight of 268.23 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxan-3-yl) 2-methyl-2-(trifluoromethyl)butanoate is sourced from PubChem (CID 59502978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).