C21H26N6O3S2Si — CID 59503571
methyl 5-[[6-methyl-3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyrazin-8-yl]-(2-trimethylsilylethoxymethyl)amino]-1,2-thiazole-3-carboxylate (PubChem CID 59503571) has the molecular formula C21H26N6O3S2Si and a molecular weight of 502.70 g/mol. Its IUPAC name is methyl 5-[[6-methyl-3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyrazin-8-yl]-(2-trimethylsilylethoxymethyl)amino]-1,2-thiazole-3-carboxylate.
| Compound Name | methyl 5-[[6-methyl-3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyrazin-8-yl]-(2-trimethylsilylethoxymethyl)amino]-1,2-thiazole-3-carboxylate |
|---|---|
| PubChem CID | 59503571 |
| Molecular Formula | C21H26N6O3S2Si |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | methyl 5-[[6-methyl-3-(1,3-thiazol-2-yl)imidazo[1,2-a]pyrazin-8-yl]-(2-trimethylsilylethoxymethyl)amino]-1,2-thiazole-3-carboxylate |
| SMILES | COC(=O)c1cc(N(COCC[Si](C)(C)C)c2nc(C)cn3c(-c4nccs4)cnc23)sn1 |
| InChI | InChI=1S/C21H26N6O3S2Si/c1-14-12-26-16(20-22-6-8-31-20)11-23-18(26)19(24-14)27(13-30-7-9-33(3,4)5)17-10-15(25-32-17)21(28)29-2/h6,8,10-12H,7,9,13H2,1-5H3 |
| InChIKey | AXFDEFCDGFTPHB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|