C27H41N7O4SSi2 — CID 59503775
methyl 5-[[6-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]-(2-trimethylsilylethoxymethyl)amino]-1,2-thiazole-3-carboxylate (PubChem CID 59503775) has the molecular formula C27H41N7O4SSi2 and a molecular weight of 615.91 g/mol. Its IUPAC name is methyl 5-[[6-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]-(2-trimethylsilylethoxymethyl)amino]-1,2-thiazole-3-carboxylate.
| Compound Name | methyl 5-[[6-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]-(2-trimethylsilylethoxymethyl)amino]-1,2-thiazole-3-carboxylate |
|---|---|
| PubChem CID | 59503775 |
| Molecular Formula | C27H41N7O4SSi2 |
| Molecular Weight | 615.91 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | methyl 5-[[6-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]-(2-trimethylsilylethoxymethyl)amino]-1,2-thiazole-3-carboxylate |
| SMILES | COC(=O)c1cc(N(COCC[Si](C)(C)C)c2nc(C)cn3c(-c4cnn(COCC[Si](C)(C)C)c4)cnc23)sn1 |
| InChI | InChI=1S/C27H41N7O4SSi2/c1-20-16-33-23(21-14-29-32(17-21)18-37-9-11-40(3,4)5)15-28-25(33)26(30-20)34(19-38-10-12-41(6,7)8)24-13-22(31-39-24)27(35)36-2/h13-17H,9-12,18-19H2,1-8H3 |
| InChIKey | KPIJXUYSYDAIRT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.91 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|