C23H28N8S — CID 59503784
3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-N-[6-methyl-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine (PubChem CID 59503784) has the molecular formula C23H28N8S and a molecular weight of 448.60 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-N-[6-methyl-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-N-[6-methyl-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 59503784 |
| Molecular Formula | C23H28N8S |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)-N-[6-methyl-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine |
| SMILES | Cc1cn2c(-c3cn[nH]c3)cnc2c(Nc2cc(CN3CCCC4CCCCC43)ns2)n1 |
| InChI | InChI=1S/C23H28N8S/c1-15-13-31-20(17-10-25-26-11-17)12-24-23(31)22(27-15)28-21-9-18(29-32-21)14-30-8-4-6-16-5-2-3-7-19(16)30/h9-13,16,19H,2-8,14H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | VYHSZVTVSRCGRO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |