C20H26N10OSSi — CID 59503788
3-(azidomethyl)-N-[6-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine (PubChem CID 59503788) has the molecular formula C20H26N10OSSi and a molecular weight of 482.65 g/mol. Its IUPAC name is 3-(azidomethyl)-N-[6-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine.
| Compound Name | 3-(azidomethyl)-N-[6-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 59503788 |
| Molecular Formula | C20H26N10OSSi |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 3-(azidomethyl)-N-[6-methyl-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine |
| SMILES | Cc1cn2c(-c3cnn(COCC[Si](C)(C)C)c3)cnc2c(Nc2cc(CN=[N+]=[N-])ns2)n1 |
| InChI | InChI=1S/C20H26N10OSSi/c1-14-11-30-17(15-8-24-29(12-15)13-31-5-6-33(2,3)4)10-22-20(30)19(25-14)26-18-7-16(27-32-18)9-23-28-21/h7-8,10-12H,5-6,9,13H2,1-4H3,(H,25,26) |
| InChIKey | NBYIALQCACHGPF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|