C8H15O3Y- — CID 59503941
2-ethyl-6-methoxy-3,4,5,6-tetrahydro-2H-pyran-5-id-4-ol;yttrium (PubChem CID 59503941) has the molecular formula C8H15O3Y- and a molecular weight of 248.11 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-3,4,5,6-tetrahydro-2H-pyran-5-id-4-ol;yttrium.
| Compound Name | 2-ethyl-6-methoxy-3,4,5,6-tetrahydro-2H-pyran-5-id-4-ol;yttrium |
|---|---|
| PubChem CID | 59503941 |
| Molecular Formula | C8H15O3Y- |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 2-ethyl-6-methoxy-3,4,5,6-tetrahydro-2H-pyran-5-id-4-ol;yttrium |
| SMILES | CCC1CC(O)[CH-]C(OC)O1.[Y] |
| InChI | InChI=1S/C8H15O3.Y/c1-3-7-4-6(9)5-8(10-2)11-7;/h5-9H,3-4H2,1-2H3;/q-1; |
| InChIKey | NOTCXBJUECXWLQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|