About 6-methyl-5-methylideneoxane-3,4-diol
6-methyl-5-methylideneoxane-3,4-diol (PubChem CID 59503945) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 6-methyl-5-methylideneoxane-3,4-diol.
Molecular Properties
| Compound Name | 6-methyl-5-methylideneoxane-3,4-diol |
| PubChem CID | 59503945 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 6-methyl-5-methylideneoxane-3,4-diol |
| SMILES | C=C1C(C)OCC(O)C1O |
| InChI | InChI=1S/C7H12O3/c1-4-5(2)10-3-6(8)7(4)9/h5-9H,1,3H2,2H3 |
| InChIKey | PFIXAPOLRVFENM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-5-methylideneoxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-methylideneoxane-3,4-diol?
The IUPAC name of 6-methyl-5-methylideneoxane-3,4-diol (CID 59503945) is 6-methyl-5-methylideneoxane-3,4-diol.
What is the SMILES notation for 6-methyl-5-methylideneoxane-3,4-diol?
The canonical SMILES for 6-methyl-5-methylideneoxane-3,4-diol is C=C1C(C)OCC(O)C1O.
What is the InChIKey of 6-methyl-5-methylideneoxane-3,4-diol?
The InChIKey is PFIXAPOLRVFENM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-4-5(2)10-3-6(8)7(4)9/h5-9H,1,3H2,2H3.
What are the key properties of 6-methyl-5-methylideneoxane-3,4-diol?
6-methyl-5-methylideneoxane-3,4-diol has a molecular weight of 144.17 g/mol, XLogP of -0.32, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-methylideneoxane-3,4-diol is sourced from PubChem (CID 59503945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).