C14H16F2IN3O6 — CID 59503985
[(2R,3R,5R)-2-(1-acetyloxyethyl)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-4,4-difluorooxolan-3-yl] acetate (PubChem CID 59503985) has the molecular formula C14H16F2IN3O6 and a molecular weight of 487.20 g/mol. Its IUPAC name is [(2R,3R,5R)-2-(1-acetyloxyethyl)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-4,4-difluorooxolan-3-yl] acetate.
| Compound Name | [(2R,3R,5R)-2-(1-acetyloxyethyl)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-4,4-difluorooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 59503985 |
| Molecular Formula | C14H16F2IN3O6 |
| Molecular Weight | 487.20 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | [(2R,3R,5R)-2-(1-acetyloxyethyl)-5-(4-amino-5-iodo-2-oxopyrimidin-1-yl)-4,4-difluorooxolan-3-yl] acetate |
| SMILES | CC(=O)OC(C)[C@H]1O[C@@H](n2cc(I)c(N)nc2=O)C(F)(F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H16F2IN3O6/c1-5(24-6(2)21)9-10(25-7(3)22)14(15,16)12(26-9)20-4-8(17)11(18)19-13(20)23/h4-5,9-10,12H,1-3H3,(H2,18,19,23)/t5?,9-,10-,12-/m1/s1 |
| InChIKey | RKVJVFXSIASYBG-ZHKFYYCHSA-N |
| XLogP | 0.85 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|