About ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate
ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate (PubChem CID 59504259) has the molecular formula C20H32O3
and a molecular weight of 320.47 g/mol. Its IUPAC name is ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate.
Molecular Properties
| Compound Name | ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate |
| PubChem CID | 59504259 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate |
| SMILES | CCOC(=O)CC(=O)CC/C=C(\CC=C(C)C)CCC=C(C)C |
| InChI | InChI=1S/C20H32O3/c1-6-23-20(22)15-19(21)12-8-11-18(14-13-17(4)5)10-7-9-16(2)3/h9,11,13H,6-8,10,12,14-15H2,1-5H3/b18-11- |
| InChIKey | LLQIPVRSUIUJQW-WQRHYEAKSA-N |
| XLogP | 5.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate?
The IUPAC name of ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate (CID 59504259) is ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate.
What is the SMILES notation for ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate?
The canonical SMILES for ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate is CCOC(=O)CC(=O)CC/C=C(\CC=C(C)C)CCC=C(C)C.
What is the InChIKey of ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate?
The InChIKey is LLQIPVRSUIUJQW-WQRHYEAKSA-N. The full InChI is InChI=1S/C20H32O3/c1-6-23-20(22)15-19(21)12-8-11-18(14-13-17(4)5)10-7-9-16(2)3/h9,11,13H,6-8,10,12,14-15H2,1-5H3/b18-11-.
What are the key properties of ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate?
ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate has a molecular weight of 320.47 g/mol, XLogP of 5.32, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (6Z)-11-methyl-7-(3-methylbut-2-enyl)-3-oxododeca-6,10-dienoate is sourced from PubChem (CID 59504259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).