C24H30O3 — CID 59504330
(4aR,9R,10S,10aS)-6-methoxy-9-(methoxymethyl)-10-(4-methoxyphenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene (PubChem CID 59504330) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (4aR,9R,10S,10aS)-6-methoxy-9-(methoxymethyl)-10-(4-methoxyphenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene.
| Compound Name | (4aR,9R,10S,10aS)-6-methoxy-9-(methoxymethyl)-10-(4-methoxyphenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
|---|---|
| PubChem CID | 59504330 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (4aR,9R,10S,10aS)-6-methoxy-9-(methoxymethyl)-10-(4-methoxyphenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthrene |
| SMILES | COC[C@H]1c2ccc(OC)cc2[C@@H]2CCCC[C@@H]2[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C24H30O3/c1-25-15-23-20-13-12-18(27-3)14-22(20)19-6-4-5-7-21(19)24(23)16-8-10-17(26-2)11-9-16/h8-14,19,21,23-24H,4-7,15H2,1-3H3/t19-,21+,23+,24+/m1/s1 |
| InChIKey | WSHBSKCVZAAJAD-NMTNEYKDSA-N |
| XLogP | 5.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |