C24H28O4 — CID 59504340
methyl (4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-1-carboxylate (PubChem CID 59504340) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is methyl (4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 59504340 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | methyl (4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)c1cc(OC)cc2c1C[C@@H](c1ccc(OC)cc1)[C@H]1CCCC[C@@H]21 |
| InChI | InChI=1S/C24H28O4/c1-26-16-10-8-15(9-11-16)20-14-22-21(19-7-5-4-6-18(19)20)12-17(27-2)13-23(22)24(25)28-3/h8-13,18-20H,4-7,14H2,1-3H3/t18-,19+,20-/m0/s1 |
| InChIKey | NGNNEKPAQJCERU-ZCNNSNEGSA-N |
| XLogP | 5.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |