C27H32O4 — CID 59504344
ethyl (E)-3-[(4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl]prop-2-enoate (PubChem CID 59504344) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is ethyl (E)-3-[(4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59504344 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | ethyl (E)-3-[(4bR,8aR,9R)-3-methoxy-9-(4-methoxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc2c(cc1OC)[C@@H]1CCCC[C@@H]1[C@H](c1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C27H32O4/c1-4-31-27(28)14-11-19-15-20-16-24(18-9-12-21(29-2)13-10-18)22-7-5-6-8-23(22)25(20)17-26(19)30-3/h9-15,17,22-24H,4-8,16H2,1-3H3/b14-11+/t22-,23+,24-/m0/s1 |
| InChIKey | NRNINWLEDOEEOR-PNKFXHDSSA-N |
| XLogP | 5.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|