C22H23F3O5S — CID 59504416
[(3aR,4R,9bR)-8-methoxy-4-(4-methoxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl] trifluoromethanesulfonate (PubChem CID 59504416) has the molecular formula C22H23F3O5S and a molecular weight of 456.48 g/mol. Its IUPAC name is [(3aR,4R,9bR)-8-methoxy-4-(4-methoxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,4R,9bR)-8-methoxy-4-(4-methoxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59504416 |
| Molecular Formula | C22H23F3O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [(3aR,4R,9bR)-8-methoxy-4-(4-methoxyphenyl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-6-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc([C@@H]2Cc3c(OS(=O)(=O)C(F)(F)F)cc(OC)cc3[C@@H]3CCC[C@H]23)cc1 |
| InChI | InChI=1S/C22H23F3O5S/c1-28-14-8-6-13(7-9-14)18-12-20-19(17-5-3-4-16(17)18)10-15(29-2)11-21(20)30-31(26,27)22(23,24)25/h6-11,16-18H,3-5,12H2,1-2H3/t16-,17+,18-/m0/s1 |
| InChIKey | UBKMXDMXEJUDSX-KSZLIROESA-N |
| XLogP | 5.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|