About quinolizin-5-ium-1,2-diol bromide
quinolizin-5-ium-1,2-diol bromide (PubChem CID 595046) has the molecular formula C9H8BrNO2
and a molecular weight of 242.07 g/mol. Its IUPAC name is quinolizin-5-ium-1,2-diol bromide.
Molecular Properties
| Compound Name | quinolizin-5-ium-1,2-diol bromide |
| PubChem CID | 595046 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | quinolizin-5-ium-1,2-diol bromide |
| SMILES | Oc1cc[n+]2ccccc2c1O.[Br-] |
| InChI | InChI=1S/C9H7NO2.BrH/c11-8-4-6-10-5-2-1-3-7(10)9(8)12;/h1-6,12H;1H |
| InChIKey | IGNYZACYQPAROL-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 44.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze quinolizin-5-ium-1,2-diol bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolizin-5-ium-1,2-diol bromide?
The IUPAC name of quinolizin-5-ium-1,2-diol bromide (CID 595046) is quinolizin-5-ium-1,2-diol bromide.
What is the SMILES notation for quinolizin-5-ium-1,2-diol bromide?
The canonical SMILES for quinolizin-5-ium-1,2-diol bromide is Oc1cc[n+]2ccccc2c1O.[Br-].
What is the InChIKey of quinolizin-5-ium-1,2-diol bromide?
The InChIKey is IGNYZACYQPAROL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2.BrH/c11-8-4-6-10-5-2-1-3-7(10)9(8)12;/h1-6,12H;1H.
What are the key properties of quinolizin-5-ium-1,2-diol bromide?
quinolizin-5-ium-1,2-diol bromide has a molecular weight of 242.07 g/mol, XLogP of -2.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolizin-5-ium-1,2-diol bromide is sourced from PubChem (CID 595046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).