About 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile
4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile (PubChem CID 59504789) has the molecular formula C17H16F2IN3
and a molecular weight of 427.24 g/mol. Its IUPAC name is 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile |
| PubChem CID | 59504789 |
| Molecular Formula | C17H16F2IN3 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile |
| SMILES | CC(C)n1nc(-c2ccc(C#N)cc2)c(C2CC(F)(F)C2)c1I |
| InChI | InChI=1S/C17H16F2IN3/c1-10(2)23-16(20)14(13-7-17(18,19)8-13)15(22-23)12-5-3-11(9-21)4-6-12/h3-6,10,13H,7-8H2,1-2H3 |
| InChIKey | JYDKWLLGKRUMOT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile?
The IUPAC name of 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile (CID 59504789) is 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile.
What is the SMILES notation for 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile?
The canonical SMILES for 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile is CC(C)n1nc(-c2ccc(C#N)cc2)c(C2CC(F)(F)C2)c1I.
What is the InChIKey of 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile?
The InChIKey is JYDKWLLGKRUMOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16F2IN3/c1-10(2)23-16(20)14(13-7-17(18,19)8-13)15(22-23)12-5-3-11(9-21)4-6-12/h3-6,10,13H,7-8H2,1-2H3.
What are the key properties of 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile?
4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile has a molecular weight of 427.24 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,3-difluorocyclobutyl)-5-iodo-1-propan-2-ylpyrazol-3-yl]benzonitrile is sourced from PubChem (CID 59504789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).